C31H34N2O3S — CID 10029476
2-methylpropyl 4-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentoxy]benzoate (PubChem CID 10029476) has the molecular formula C31H34N2O3S and a molecular weight of 514.69 g/mol. Its IUPAC name is 2-methylpropyl 4-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentoxy]benzoate.
| Compound Name | 2-methylpropyl 4-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentoxy]benzoate |
|---|---|
| PubChem CID | 10029476 |
| Molecular Formula | C31H34N2O3S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 2-methylpropyl 4-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentoxy]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(OCCCCCSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C31H34N2O3S/c1-23(2)22-36-30(34)26-16-18-27(19-17-26)35-20-10-5-11-21-37-31-32-28(24-12-6-3-7-13-24)29(33-31)25-14-8-4-9-15-25/h3-4,6-9,12-19,23H,5,10-11,20-22H2,1-2H3,(H,32,33) |
| InChIKey | NFPSZKVVSCQLRW-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|