C27H32N2O4S — CID 142807159
2-methylpropyl 4-[3-[[5-[(Z)-but-2-enyl]-4-phenyl-1H-imidazol-2-yl]sulfanyl]-2-hydroxypropoxy]benzoate (PubChem CID 142807159) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is 2-methylpropyl 4-[3-[[5-[(Z)-but-2-enyl]-4-phenyl-1H-imidazol-2-yl]sulfanyl]-2-hydroxypropoxy]benzoate.
| Compound Name | 2-methylpropyl 4-[3-[[5-[(Z)-but-2-enyl]-4-phenyl-1H-imidazol-2-yl]sulfanyl]-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 142807159 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-methylpropyl 4-[3-[[5-[(Z)-but-2-enyl]-4-phenyl-1H-imidazol-2-yl]sulfanyl]-2-hydroxypropoxy]benzoate |
| SMILES | C/C=C\Cc1[nH]c(SCC(O)COc2ccc(C(=O)OCC(C)C)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H32N2O4S/c1-4-5-11-24-25(20-9-7-6-8-10-20)29-27(28-24)34-18-22(30)17-32-23-14-12-21(13-15-23)26(31)33-16-19(2)3/h4-10,12-15,19,22,30H,11,16-18H2,1-3H3,(H,28,29)/b5-4- |
| InChIKey | FWHXAAKYNRVWHT-PLNGDYQASA-N |
| XLogP | 5.54 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|