C19H19NO5S — CID 67907081
ethyl 4-[3-(1,3-benzoxazol-2-ylsulfanyl)-2-hydroxypropoxy]benzoate (PubChem CID 67907081) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is ethyl 4-[3-(1,3-benzoxazol-2-ylsulfanyl)-2-hydroxypropoxy]benzoate.
| Compound Name | ethyl 4-[3-(1,3-benzoxazol-2-ylsulfanyl)-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 67907081 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | ethyl 4-[3-(1,3-benzoxazol-2-ylsulfanyl)-2-hydroxypropoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(O)CSc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C19H19NO5S/c1-2-23-18(22)13-7-9-15(10-8-13)24-11-14(21)12-26-19-20-16-5-3-4-6-17(16)25-19/h3-10,14,21H,2,11-12H2,1H3 |
| InChIKey | MDGKSSVKGMAIKJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |