C24H17N3O3S — CID 23800005
ethyl 4-[4-(1,3-benzoxazol-2-ylsulfanyl)phthalazin-1-yl]benzoate (PubChem CID 23800005) has the molecular formula C24H17N3O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is ethyl 4-[4-(1,3-benzoxazol-2-ylsulfanyl)phthalazin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-(1,3-benzoxazol-2-ylsulfanyl)phthalazin-1-yl]benzoate |
|---|---|
| PubChem CID | 23800005 |
| Molecular Formula | C24H17N3O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | ethyl 4-[4-(1,3-benzoxazol-2-ylsulfanyl)phthalazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2nnc(Sc3nc4ccccc4o3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H17N3O3S/c1-2-29-23(28)16-13-11-15(12-14-16)21-17-7-3-4-8-18(17)22(27-26-21)31-24-25-19-9-5-6-10-20(19)30-24/h3-14H,2H2,1H3 |
| InChIKey | MPOVBEAPQNHIGV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |