C11H13NO3S — CID 5333015
1-(1,3-benzoxazol-2-ylsulfanyl)-3-methoxypropan-2-ol (PubChem CID 5333015) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-ylsulfanyl)-3-methoxypropan-2-ol.
| Compound Name | 1-(1,3-benzoxazol-2-ylsulfanyl)-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 5333015 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 1-(1,3-benzoxazol-2-ylsulfanyl)-3-methoxypropan-2-ol |
| SMILES | COCC(O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H13NO3S/c1-14-6-8(13)7-16-11-12-9-4-2-3-5-10(9)15-11/h2-5,8,13H,6-7H2,1H3 |
| InChIKey | CELQNDQHCZDJTD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |