C34H40N2O3S — CID 10257141
2-methylpropyl 4-[8-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]octoxy]benzoate (PubChem CID 10257141) has the molecular formula C34H40N2O3S and a molecular weight of 556.77 g/mol. Its IUPAC name is 2-methylpropyl 4-[8-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]octoxy]benzoate.
| Compound Name | 2-methylpropyl 4-[8-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]octoxy]benzoate |
|---|---|
| PubChem CID | 10257141 |
| Molecular Formula | C34H40N2O3S |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 2-methylpropyl 4-[8-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]octoxy]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(OCCCCCCCCSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C34H40N2O3S/c1-26(2)25-39-33(37)29-19-21-30(22-20-29)38-23-13-5-3-4-6-14-24-40-34-35-31(27-15-9-7-10-16-27)32(36-34)28-17-11-8-12-18-28/h7-12,15-22,26H,3-6,13-14,23-25H2,1-2H3,(H,35,36) |
| InChIKey | QXWTYTKASWWHLA-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|