C26H25N3O3S — CID 10411893
2-[5-(4-nitrophenoxy)pentylsulfanyl]-4,5-diphenyl-1H-imidazole (PubChem CID 10411893) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-[5-(4-nitrophenoxy)pentylsulfanyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[5-(4-nitrophenoxy)pentylsulfanyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 10411893 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[5-(4-nitrophenoxy)pentylsulfanyl]-4,5-diphenyl-1H-imidazole |
| SMILES | O=[N+]([O-])c1ccc(OCCCCCSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C26H25N3O3S/c30-29(31)22-14-16-23(17-15-22)32-18-8-3-9-19-33-26-27-24(20-10-4-1-5-11-20)25(28-26)21-12-6-2-7-13-21/h1-2,4-7,10-17H,3,8-9,18-19H2,(H,27,28) |
| InChIKey | GYTNCNWKDMDEMG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|