C22H22N4S — CID 67901340
2-[4-(1H-imidazol-2-yl)butylsulfanyl]-4,5-diphenyl-1H-imidazole (PubChem CID 67901340) has the molecular formula C22H22N4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[4-(1H-imidazol-2-yl)butylsulfanyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[4-(1H-imidazol-2-yl)butylsulfanyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 67901340 |
| Molecular Formula | C22H22N4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[4-(1H-imidazol-2-yl)butylsulfanyl]-4,5-diphenyl-1H-imidazole |
| SMILES | c1ccc(-c2nc(SCCCCc3ncc[nH]3)[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N4S/c1-3-9-17(10-4-1)20-21(18-11-5-2-6-12-18)26-22(25-20)27-16-8-7-13-19-23-14-15-24-19/h1-6,9-12,14-15H,7-8,13,16H2,(H,23,24)(H,25,26) |
| InChIKey | YGLHBRPJYDIVDJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|