C24H25N3O4S — CID 135697570
4-methyl-2-[5-[4-[(E)-2-(4-nitrophenyl)ethenyl]phenoxy]pentylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 135697570) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-methyl-2-[5-[4-[(E)-2-(4-nitrophenyl)ethenyl]phenoxy]pentylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-[5-[4-[(E)-2-(4-nitrophenyl)ethenyl]phenoxy]pentylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135697570 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-methyl-2-[5-[4-[(E)-2-(4-nitrophenyl)ethenyl]phenoxy]pentylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(SCCCCCOc2ccc(/C=C/c3ccc([N+](=O)[O-])cc3)cc2)n1 |
| InChI | InChI=1S/C24H25N3O4S/c1-18-17-23(28)26-24(25-18)32-16-4-2-3-15-31-22-13-9-20(10-14-22)6-5-19-7-11-21(12-8-19)27(29)30/h5-14,17H,2-4,15-16H2,1H3,(H,25,26,28)/b6-5+ |
| InChIKey | XSLPGMREVOCYNN-AATRIKPKSA-N |
| XLogP | 5.50 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|