C14H16ClN3O2S — CID 136685962
4-amino-2-[4-(4-chlorophenoxy)butylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 136685962) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 4-amino-2-[4-(4-chlorophenoxy)butylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[4-(4-chlorophenoxy)butylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136685962 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-amino-2-[4-(4-chlorophenoxy)butylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCCCCOc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H16ClN3O2S/c15-10-3-5-11(6-4-10)20-7-1-2-8-21-14-17-12(16)9-13(19)18-14/h3-6,9H,1-2,7-8H2,(H3,16,17,18,19) |
| InChIKey | RVAOJGPFDXPLGF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|