C14H15ClN2O3S — CID 136684367
2-[2-(4-chlorophenoxy)ethylsulfanyl]-4-(methoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136684367) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethylsulfanyl]-4-(methoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-4-(methoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136684367 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-4-(methoxymethyl)-1H-pyrimidin-6-one |
| SMILES | COCc1cc(=O)[nH]c(SCCOc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H15ClN2O3S/c1-19-9-11-8-13(18)17-14(16-11)21-7-6-20-12-4-2-10(15)3-5-12/h2-5,8H,6-7,9H2,1H3,(H,16,17,18) |
| InChIKey | AOWURINMAICROY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|