C19H26N2O2S — CID 136685035
2-[2-(4-tert-butylphenoxy)ethylsulfanyl]-4-propyl-1H-pyrimidin-6-one (PubChem CID 136685035) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenoxy)ethylsulfanyl]-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(4-tert-butylphenoxy)ethylsulfanyl]-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136685035 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[2-(4-tert-butylphenoxy)ethylsulfanyl]-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(SCCOc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C19H26N2O2S/c1-5-6-15-13-17(22)21-18(20-15)24-12-11-23-16-9-7-14(8-10-16)19(2,3)4/h7-10,13H,5-6,11-12H2,1-4H3,(H,20,21,22) |
| InChIKey | WVFHMTWUOCTXMJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|