C17H22N2O2S2 — CID 136686243
2-[2-(4-methylphenoxy)ethylsulfanyl]-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 136686243) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[2-(4-methylphenoxy)ethylsulfanyl]-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(4-methylphenoxy)ethylsulfanyl]-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136686243 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-[2-(4-methylphenoxy)ethylsulfanyl]-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(OCCSc2nc(CSC(C)C)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H22N2O2S2/c1-12(2)23-11-14-10-16(20)19-17(18-14)22-9-8-21-15-6-4-13(3)5-7-15/h4-7,10,12H,8-9,11H2,1-3H3,(H,18,19,20) |
| InChIKey | QGFIZZHDOMMZIW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|