C15H17FN2OS2 — CID 136686222
2-[(4-fluorophenyl)methylsulfanyl]-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 136686222) has the molecular formula C15H17FN2OS2 and a molecular weight of 324.45 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136686222 |
| Molecular Formula | C15H17FN2OS2 |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-4-(propan-2-ylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)SCc1cc(=O)[nH]c(SCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H17FN2OS2/c1-10(2)20-9-13-7-14(19)18-15(17-13)21-8-11-3-5-12(16)6-4-11/h3-7,10H,8-9H2,1-2H3,(H,17,18,19) |
| InChIKey | HGELZJZWQWPIKS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |