C15H17N3O4S — CID 136687172
2-[(4-nitrophenyl)methylsulfanyl]-4-(propan-2-yloxymethyl)-1H-pyrimidin-6-one (PubChem CID 136687172) has the molecular formula C15H17N3O4S and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methylsulfanyl]-4-(propan-2-yloxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[(4-nitrophenyl)methylsulfanyl]-4-(propan-2-yloxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136687172 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[(4-nitrophenyl)methylsulfanyl]-4-(propan-2-yloxymethyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)OCc1cc(=O)[nH]c(SCc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C15H17N3O4S/c1-10(2)22-8-12-7-14(19)17-15(16-12)23-9-11-3-5-13(6-4-11)18(20)21/h3-7,10H,8-9H2,1-2H3,(H,16,17,19) |
| InChIKey | QKGJZRVWZHQICX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|