C17H22N2O4S — CID 136687252
2-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-(propan-2-yloxymethyl)-1H-pyrimidin-6-one (PubChem CID 136687252) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-(propan-2-yloxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-(propan-2-yloxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136687252 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-4-(propan-2-yloxymethyl)-1H-pyrimidin-6-one |
| SMILES | COc1ccc(OCCSc2nc(COC(C)C)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-12(2)23-11-13-10-16(20)19-17(18-13)24-9-8-22-15-6-4-14(21-3)5-7-15/h4-7,10,12H,8-9,11H2,1-3H3,(H,18,19,20) |
| InChIKey | XNVWDSXKNOINRD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|