C19H26N2O2S2 — CID 136686722
2-[2-(4-tert-butylphenoxy)ethylsulfanyl]-4-(ethylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 136686722) has the molecular formula C19H26N2O2S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenoxy)ethylsulfanyl]-4-(ethylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(4-tert-butylphenoxy)ethylsulfanyl]-4-(ethylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136686722 |
| Molecular Formula | C19H26N2O2S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[2-(4-tert-butylphenoxy)ethylsulfanyl]-4-(ethylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | CCSCc1cc(=O)[nH]c(SCCOc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C19H26N2O2S2/c1-5-24-13-15-12-17(22)21-18(20-15)25-11-10-23-16-8-6-14(7-9-16)19(2,3)4/h6-9,12H,5,10-11,13H2,1-4H3,(H,20,21,22) |
| InChIKey | GRJQJHFMXDXCHX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|