C8H12N2OS2 — CID 137014941
2-ethylsulfanyl-4-(methylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 137014941) has the molecular formula C8H12N2OS2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-ethylsulfanyl-4-(methylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-ethylsulfanyl-4-(methylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137014941 |
| Molecular Formula | C8H12N2OS2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-ethylsulfanyl-4-(methylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | CCSc1nc(CSC)cc(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2OS2/c1-3-13-8-9-6(5-12-2)4-7(11)10-8/h4H,3,5H2,1-2H3,(H,9,10,11) |
| InChIKey | UORRMGSXLLNDGH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |