C6H9N3OS — CID 135934367
4-(aminomethyl)-2-methylsulfanyl-1H-pyrimidin-6-one (PubChem CID 135934367) has the molecular formula C6H9N3OS and a molecular weight of 171.23 g/mol. Its IUPAC name is 4-(aminomethyl)-2-methylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-(aminomethyl)-2-methylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135934367 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.23 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-(aminomethyl)-2-methylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CSc1nc(CN)cc(=O)[nH]1 |
| InChI | InChI=1S/C6H9N3OS/c1-11-6-8-4(3-7)2-5(10)9-6/h2H,3,7H2,1H3,(H,8,9,10) |
| InChIKey | BJVVQDSUVDFVHA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |