C22H38N2OS — CID 137178356
4-heptadec-8-enyl-2-methylsulfanyl-1H-pyrimidin-6-one (PubChem CID 137178356) has the molecular formula C22H38N2OS and a molecular weight of 378.63 g/mol. Its IUPAC name is 4-heptadec-8-enyl-2-methylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-heptadec-8-enyl-2-methylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137178356 |
| Molecular Formula | C22H38N2OS |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 4-heptadec-8-enyl-2-methylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CCCCCCCCC=CCCCCCCCc1cc(=O)[nH]c(SC)n1 |
| InChI | InChI=1S/C22H38N2OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19-21(25)24-22(23-20)26-2/h10-11,19H,3-9,12-18H2,1-2H3,(H,23,24,25) |
| InChIKey | WONSSOJSORXBDA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|