C20H33N3OS — CID 137252836
3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienyl]sulfanyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137252836) has the molecular formula C20H33N3OS and a molecular weight of 363.57 g/mol. Its IUPAC name is 3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienyl]sulfanyl-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienyl]sulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137252836 |
| Molecular Formula | C20H33N3OS |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienyl]sulfanyl-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCSc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C20H33N3OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-20-21-19(24)22-23-20/h6-7,9-10,12-13H,2-5,8,11,14-18H2,1H3,(H2,21,22,23,24)/b7-6-,10-9-,13-12- |
| InChIKey | DTVLUWBUMRRWJZ-QNEBEIHSSA-N |
| XLogP | 5.78 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|