C19H35N5OS — CID 66556451
1-pentyl-3-[(Z)-11-(1H-1,2,4-triazol-5-ylsulfanyl)undec-5-enyl]urea (PubChem CID 66556451) has the molecular formula C19H35N5OS and a molecular weight of 381.59 g/mol. Its IUPAC name is 1-pentyl-3-[(Z)-11-(1H-1,2,4-triazol-5-ylsulfanyl)undec-5-enyl]urea.
| Compound Name | 1-pentyl-3-[(Z)-11-(1H-1,2,4-triazol-5-ylsulfanyl)undec-5-enyl]urea |
|---|---|
| PubChem CID | 66556451 |
| Molecular Formula | C19H35N5OS |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 1-pentyl-3-[(Z)-11-(1H-1,2,4-triazol-5-ylsulfanyl)undec-5-enyl]urea |
| SMILES | CCCCCNC(=O)NCCCC/C=C\CCCCCSc1ncn[nH]1 |
| InChI | InChI=1S/C19H35N5OS/c1-2-3-11-14-20-18(25)21-15-12-9-7-5-4-6-8-10-13-16-26-19-22-17-23-24-19/h4-5,17H,2-3,6-16H2,1H3,(H2,20,21,25)(H,22,23,24)/b5-4- |
| InChIKey | CWNBRLSEBLTEGU-PLNGDYQASA-N |
| XLogP | 4.67 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|