C24H41N3O — CID 71770552
1-[(Z)-heptadec-8-enyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 71770552) has the molecular formula C24H41N3O and a molecular weight of 387.61 g/mol. Its IUPAC name is 1-[(Z)-heptadec-8-enyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[(Z)-heptadec-8-enyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 71770552 |
| Molecular Formula | C24H41N3O |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.32 |
| IUPAC Name | 1-[(Z)-heptadec-8-enyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CCCCCCCC/C=C\CCCCCCCNC(=O)NCc1cccnc1 |
| InChI | InChI=1S/C24H41N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-26-24(28)27-22-23-18-17-19-25-21-23/h9-10,17-19,21H,2-8,11-16,20,22H2,1H3,(H2,26,27,28)/b10-9- |
| InChIKey | QPVHCPOCTLFHEW-KTKRTIGZSA-N |
| XLogP | 6.53 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|