C17H29N3O — CID 43600563
N-[3-(pyridin-3-ylmethylamino)propyl]octanamide (PubChem CID 43600563) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[3-(pyridin-3-ylmethylamino)propyl]octanamide.
| Compound Name | N-[3-(pyridin-3-ylmethylamino)propyl]octanamide |
|---|---|
| PubChem CID | 43600563 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | N-[3-(pyridin-3-ylmethylamino)propyl]octanamide |
| SMILES | CCCCCCCC(=O)NCCCNCc1cccnc1 |
| InChI | InChI=1S/C17H29N3O/c1-2-3-4-5-6-10-17(21)20-13-8-12-19-15-16-9-7-11-18-14-16/h7,9,11,14,19H,2-6,8,10,12-13,15H2,1H3,(H,20,21) |
| InChIKey | DQDIAEFKNQMVGP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|