C20H36N4O2S — CID 123587244
1-pentyl-3-[12-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)dodec-5-enyl]urea (PubChem CID 123587244) has the molecular formula C20H36N4O2S and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-pentyl-3-[12-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)dodec-5-enyl]urea.
| Compound Name | 1-pentyl-3-[12-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)dodec-5-enyl]urea |
|---|---|
| PubChem CID | 123587244 |
| Molecular Formula | C20H36N4O2S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 1-pentyl-3-[12-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)dodec-5-enyl]urea |
| SMILES | CCCCCNC(=O)NCCCCC=CCCCCCCc1nc(=S)o[nH]1 |
| InChI | InChI=1S/C20H36N4O2S/c1-2-3-13-16-21-19(25)22-17-14-11-9-7-5-4-6-8-10-12-15-18-23-20(27)26-24-18/h5,7H,2-4,6,8-17H2,1H3,(H2,21,22,25)(H,23,24,27) |
| InChIKey | BDTWACPGBSEJAX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|