C20H38N4O2S — CID 118987783
1-pentyl-3-[(Z)-12-(5-sulfanylidene-1,2,4-oxadiazolidin-3-yl)dodec-5-enyl]urea (PubChem CID 118987783) has the molecular formula C20H38N4O2S and a molecular weight of 398.62 g/mol. Its IUPAC name is 1-pentyl-3-[(Z)-12-(5-sulfanylidene-1,2,4-oxadiazolidin-3-yl)dodec-5-enyl]urea.
| Compound Name | 1-pentyl-3-[(Z)-12-(5-sulfanylidene-1,2,4-oxadiazolidin-3-yl)dodec-5-enyl]urea |
|---|---|
| PubChem CID | 118987783 |
| Molecular Formula | C20H38N4O2S |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 1-pentyl-3-[(Z)-12-(5-sulfanylidene-1,2,4-oxadiazolidin-3-yl)dodec-5-enyl]urea |
| SMILES | CCCCCNC(=O)NCCCC/C=C\CCCCCCC1NOC(=S)N1 |
| InChI | InChI=1S/C20H38N4O2S/c1-2-3-13-16-21-19(25)22-17-14-11-9-7-5-4-6-8-10-12-15-18-23-20(27)26-24-18/h5,7,18,24H,2-4,6,8-17H2,1H3,(H,23,27)(H2,21,22,25)/b7-5- |
| InChIKey | RFCUPDZADMSVTO-ALCCZGGFSA-N |
| XLogP | 4.28 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|