C22H39N3O2S — CID 90132320
1-[(E)-12-(2-methylidene-4-oxo-1,3-thiazolidin-5-yl)dodec-5-enyl]-3-pentylurea (PubChem CID 90132320) has the molecular formula C22H39N3O2S and a molecular weight of 409.64 g/mol. Its IUPAC name is 1-[(E)-12-(2-methylidene-4-oxo-1,3-thiazolidin-5-yl)dodec-5-enyl]-3-pentylurea.
| Compound Name | 1-[(E)-12-(2-methylidene-4-oxo-1,3-thiazolidin-5-yl)dodec-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 90132320 |
| Molecular Formula | C22H39N3O2S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | 1-[(E)-12-(2-methylidene-4-oxo-1,3-thiazolidin-5-yl)dodec-5-enyl]-3-pentylurea |
| SMILES | C=C1NC(=O)C(CCCCCC/C=C/CCCCNC(=O)NCCCCC)S1 |
| InChI | InChI=1S/C22H39N3O2S/c1-3-4-14-17-23-22(27)24-18-15-12-10-8-6-5-7-9-11-13-16-20-21(26)25-19(2)28-20/h6,8,20H,2-5,7,9-18H2,1H3,(H,25,26)(H2,23,24,27)/b8-6+ |
| InChIKey | PQFQGWZNXVLNNN-SOFGYWHQSA-N |
| XLogP | 5.25 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|