C21H37N3O2S — CID 90132298
1-[(Z)-11-(2-methylidene-4-oxo-1,3-thiazolidin-5-yl)undec-5-enyl]-3-pentylurea (PubChem CID 90132298) has the molecular formula C21H37N3O2S and a molecular weight of 395.61 g/mol. Its IUPAC name is 1-[(Z)-11-(2-methylidene-4-oxo-1,3-thiazolidin-5-yl)undec-5-enyl]-3-pentylurea.
| Compound Name | 1-[(Z)-11-(2-methylidene-4-oxo-1,3-thiazolidin-5-yl)undec-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 90132298 |
| Molecular Formula | C21H37N3O2S |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 1-[(Z)-11-(2-methylidene-4-oxo-1,3-thiazolidin-5-yl)undec-5-enyl]-3-pentylurea |
| SMILES | C=C1NC(=O)C(CCCCC/C=C\CCCCNC(=O)NCCCCC)S1 |
| InChI | InChI=1S/C21H37N3O2S/c1-3-4-13-16-22-21(26)23-17-14-11-9-7-5-6-8-10-12-15-19-20(25)24-18(2)27-19/h5,7,19H,2-4,6,8-17H2,1H3,(H,24,25)(H2,22,23,26)/b7-5- |
| InChIKey | LVFVYSHZPUDSIA-ALCCZGGFSA-N |
| XLogP | 4.86 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|