C19H34N4O3 — CID 136631992
1-[(E)-11-(5-oxo-4H-1,2,4-oxadiazol-3-yl)undec-5-enyl]-3-pentylurea (PubChem CID 136631992) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[(E)-11-(5-oxo-4H-1,2,4-oxadiazol-3-yl)undec-5-enyl]-3-pentylurea.
| Compound Name | 1-[(E)-11-(5-oxo-4H-1,2,4-oxadiazol-3-yl)undec-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 136631992 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 1-[(E)-11-(5-oxo-4H-1,2,4-oxadiazol-3-yl)undec-5-enyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCCCC/C=C/CCCCCc1noc(=O)[nH]1 |
| InChI | InChI=1S/C19H34N4O3/c1-2-3-12-15-20-18(24)21-16-13-10-8-6-4-5-7-9-11-14-17-22-19(25)26-23-17/h4,6H,2-3,5,7-16H2,1H3,(H2,20,21,24)(H,22,23,25)/b6-4+ |
| InChIKey | XSUAUTZDIXUWLZ-GQCTYLIASA-N |
| XLogP | 3.68 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|