C22H37FN2O — CID 10316739
1-(2-fluoroethyl)-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]urea (PubChem CID 10316739) has the molecular formula C22H37FN2O and a molecular weight of 364.55 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]urea.
| Compound Name | 1-(2-fluoroethyl)-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]urea |
|---|---|
| PubChem CID | 10316739 |
| Molecular Formula | C22H37FN2O |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | 1-(2-fluoroethyl)-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]urea |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCNC(=O)NCCF |
| InChI | InChI=1S/C22H37FN2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-24-22(26)25-21-19-23/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-21H2,1H3,(H2,24,25,26)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | ZNDRUZOGIIWDGZ-DOFZRALJSA-N |
| XLogP | 6.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|