C32H65N6O2+ — CID 88929101
2-aminoethyl-bis(3-aminopropyl)-[3-[[(11Z,14Z)-2-oxoicosa-11,14-dienyl]carbamoylamino]propyl]azanium (PubChem CID 88929101) has the molecular formula C32H65N6O2+ and a molecular weight of 565.91 g/mol. Its IUPAC name is 2-aminoethyl-bis(3-aminopropyl)-[3-[[(11Z,14Z)-2-oxoicosa-11,14-dienyl]carbamoylamino]propyl]azanium.
| Compound Name | 2-aminoethyl-bis(3-aminopropyl)-[3-[[(11Z,14Z)-2-oxoicosa-11,14-dienyl]carbamoylamino]propyl]azanium |
|---|---|
| PubChem CID | 88929101 |
| Molecular Formula | C32H65N6O2+ |
| Molecular Weight | 565.91 g/mol |
| Exact Mass | 565.52 |
| IUPAC Name | 2-aminoethyl-bis(3-aminopropyl)-[3-[[(11Z,14Z)-2-oxoicosa-11,14-dienyl]carbamoylamino]propyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(=O)CNC(=O)NCCC[N+](CCN)(CCCN)CCCN |
| InChI | InChI=1S/C32H64N6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-31(39)30-37-32(40)36-25-20-28-38(29-24-35,26-18-22-33)27-19-23-34/h6-7,9-10H,2-5,8,11-30,33-35H2,1H3,(H-,36,37,40)/p+1/b7-6-,10-9- |
| InChIKey | LRTNLDRRFDHMHA-HZJYTTRNSA-O |
| XLogP | 4.92 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|