C33H66N5O2+ — CID 88929136
2-aminoethyl-bis(3-aminopropyl)-[3-[[(13Z,16Z)-4-oxodocosa-13,16-dienoyl]amino]propyl]azanium (PubChem CID 88929136) has the molecular formula C33H66N5O2+ and a molecular weight of 564.92 g/mol. Its IUPAC name is 2-aminoethyl-bis(3-aminopropyl)-[3-[[(13Z,16Z)-4-oxodocosa-13,16-dienoyl]amino]propyl]azanium.
| Compound Name | 2-aminoethyl-bis(3-aminopropyl)-[3-[[(13Z,16Z)-4-oxodocosa-13,16-dienoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 88929136 |
| Molecular Formula | C33H66N5O2+ |
| Molecular Weight | 564.92 g/mol |
| Exact Mass | 564.52 |
| IUPAC Name | 2-aminoethyl-bis(3-aminopropyl)-[3-[[(13Z,16Z)-4-oxodocosa-13,16-dienoyl]amino]propyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(=O)CCC(=O)NCCC[N+](CCN)(CCCN)CCCN |
| InChI | InChI=1S/C33H65N5O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-32(39)22-23-33(40)37-27-20-30-38(31-26-36,28-18-24-34)29-19-25-35/h6-7,9-10H,2-5,8,11-31,34-36H2,1H3/p+1/b7-6-,10-9- |
| InChIKey | ZNFFKSXMUGPJBU-HZJYTTRNSA-O |
| XLogP | 5.52 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.92 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|