C23H36N2O2S — CID 155490640
7-heptadec-8-enyl-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione (PubChem CID 155490640) has the molecular formula C23H36N2O2S and a molecular weight of 404.62 g/mol. Its IUPAC name is 7-heptadec-8-enyl-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione.
| Compound Name | 7-heptadec-8-enyl-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione |
|---|---|
| PubChem CID | 155490640 |
| Molecular Formula | C23H36N2O2S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 7-heptadec-8-enyl-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione |
| SMILES | CCCCCCCCC=CCCCCCCCc1cc(=O)n2c(n1)SCC2=O |
| InChI | InChI=1S/C23H36N2O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18-21(26)25-22(27)19-28-23(25)24-20/h9-10,18H,2-8,11-17,19H2,1H3 |
| InChIKey | ZTDWMAPMYVHNAM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|