C19H34N2OS — CID 137079394
2-methylsulfanyl-4-tetradecyl-1H-pyrimidin-6-one (PubChem CID 137079394) has the molecular formula C19H34N2OS and a molecular weight of 338.56 g/mol. Its IUPAC name is 2-methylsulfanyl-4-tetradecyl-1H-pyrimidin-6-one.
| Compound Name | 2-methylsulfanyl-4-tetradecyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137079394 |
| Molecular Formula | C19H34N2OS |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2-methylsulfanyl-4-tetradecyl-1H-pyrimidin-6-one |
| SMILES | CCCCCCCCCCCCCCc1cc(=O)[nH]c(SC)n1 |
| InChI | InChI=1S/C19H34N2OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-16-18(22)21-19(20-17)23-2/h16H,3-15H2,1-2H3,(H,20,21,22) |
| InChIKey | OPYWKGATUGVRJS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|