C13H13FN2OS — CID 135561627
4-ethyl-2-[(3-fluorophenyl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 135561627) has the molecular formula C13H13FN2OS and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-ethyl-2-[(3-fluorophenyl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[(3-fluorophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135561627 |
| Molecular Formula | C13H13FN2OS |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-ethyl-2-[(3-fluorophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | CCc1cc(=O)[nH]c(SCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H13FN2OS/c1-2-11-7-12(17)16-13(15-11)18-8-9-4-3-5-10(14)6-9/h3-7H,2,8H2,1H3,(H,15,16,17) |
| InChIKey | CUEZNDIOPHIVJC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |