C19H18N2O2S2 — CID 136687143
2-[(3-methoxyphenyl)methylsulfanyl]-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 136687143) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methylsulfanyl]-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[(3-methoxyphenyl)methylsulfanyl]-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136687143 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[(3-methoxyphenyl)methylsulfanyl]-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | COc1cccc(CSc2nc(CSc3ccccc3)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C19H18N2O2S2/c1-23-16-7-5-6-14(10-16)12-25-19-20-15(11-18(22)21-19)13-24-17-8-3-2-4-9-17/h2-11H,12-13H2,1H3,(H,20,21,22) |
| InChIKey | OHBCWLPLNOGBKC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |