C11H18N2OS2 — CID 136686635
4-(ethylsulfanylmethyl)-2-(2-methylpropylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 136686635) has the molecular formula C11H18N2OS2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 4-(ethylsulfanylmethyl)-2-(2-methylpropylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(ethylsulfanylmethyl)-2-(2-methylpropylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136686635 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-(ethylsulfanylmethyl)-2-(2-methylpropylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | CCSCc1cc(=O)[nH]c(SCC(C)C)n1 |
| InChI | InChI=1S/C11H18N2OS2/c1-4-15-7-9-5-10(14)13-11(12-9)16-6-8(2)3/h5,8H,4,6-7H2,1-3H3,(H,12,13,14) |
| InChIKey | AGHFKUMNYLEHPS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |