C12H18N2O3S2 — CID 136686636
ethyl 2-[[4-(ethylsulfanylmethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propanoate (PubChem CID 136686636) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is ethyl 2-[[4-(ethylsulfanylmethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propanoate.
| Compound Name | ethyl 2-[[4-(ethylsulfanylmethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 136686636 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | ethyl 2-[[4-(ethylsulfanylmethyl)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propanoate |
| SMILES | CCOC(=O)C(C)Sc1nc(CSCC)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-4-17-11(16)8(3)19-12-13-9(7-18-5-2)6-10(15)14-12/h6,8H,4-5,7H2,1-3H3,(H,13,14,15) |
| InChIKey | KXLCEYUFJRYDOA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |