C9H11N2O3S- — CID 135557445
(2S)-2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoate (PubChem CID 135557445) has the molecular formula C9H11N2O3S- and a molecular weight of 227.26 g/mol. Its IUPAC name is (2S)-2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoate.
| Compound Name | (2S)-2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 135557445 |
| Molecular Formula | C9H11N2O3S- |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | (2S)-2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoate |
| SMILES | CCc1cc(=O)[nH]c(S[C@@H](C)C(=O)[O-])n1 |
| InChI | InChI=1S/C9H12N2O3S/c1-3-6-4-7(12)11-9(10-6)15-5(2)8(13)14/h4-5H,3H2,1-2H3,(H,13,14)(H,10,11,12)/p-1/t5-/m0/s1 |
| InChIKey | WGDBENLRBNPLNJ-YFKPBYRVSA-M |
| XLogP | -0.44 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |