C16H16F3N3O2S — CID 136684499
2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 136684499) has the molecular formula C16H16F3N3O2S and a molecular weight of 371.38 g/mol. Its IUPAC name is 2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 136684499 |
| Molecular Formula | C16H16F3N3O2S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-[(4-ethyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCc1cc(=O)[nH]c(SC(C)C(=O)Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C16H16F3N3O2S/c1-3-11-8-13(23)22-15(21-11)25-9(2)14(24)20-12-6-4-10(5-7-12)16(17,18)19/h4-9H,3H2,1-2H3,(H,20,24)(H,21,22,23) |
| InChIKey | CGGVVRGKXJHLCN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |