C19H25N3O2S2 — CID 136686891
N-(4-ethylphenyl)-2-[[6-oxo-4-(propylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]propanamide (PubChem CID 136686891) has the molecular formula C19H25N3O2S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[[6-oxo-4-(propylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]propanamide.
| Compound Name | N-(4-ethylphenyl)-2-[[6-oxo-4-(propylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 136686891 |
| Molecular Formula | C19H25N3O2S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-(4-ethylphenyl)-2-[[6-oxo-4-(propylsulfanylmethyl)-1H-pyrimidin-2-yl]sulfanyl]propanamide |
| SMILES | CCCSCc1cc(=O)[nH]c(SC(C)C(=O)Nc2ccc(CC)cc2)n1 |
| InChI | InChI=1S/C19H25N3O2S2/c1-4-10-25-12-16-11-17(23)22-19(21-16)26-13(3)18(24)20-15-8-6-14(5-2)7-9-15/h6-9,11,13H,4-5,10,12H2,1-3H3,(H,20,24)(H,21,22,23) |
| InChIKey | XLNVUXZCJGBHLM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|