C13H19N3O2S — CID 135720241
(2S)-N-cyclopropyl-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 135720241) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-cyclopropyl-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 135720241 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (2S)-N-cyclopropyl-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCCc1cc(=O)[nH]c(S[C@@H](C)C(=O)NC2CC2)n1 |
| InChI | InChI=1S/C13H19N3O2S/c1-3-4-10-7-11(17)16-13(15-10)19-8(2)12(18)14-9-5-6-9/h7-9H,3-6H2,1-2H3,(H,14,18)(H,15,16,17)/t8-/m0/s1 |
| InChIKey | CSIYZJSKZKFYHB-QMMMGPOBSA-N |
| XLogP | 1.48 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |