C18H22N4O3S — CID 135901443
(2R)-N-(benzylcarbamoyl)-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide (PubChem CID 135901443) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is (2R)-N-(benzylcarbamoyl)-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-(benzylcarbamoyl)-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 135901443 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (2R)-N-(benzylcarbamoyl)-2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]propanamide |
| SMILES | CCCc1cc(=O)[nH]c(S[C@H](C)C(=O)NC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C18H22N4O3S/c1-3-7-14-10-15(23)21-18(20-14)26-12(2)16(24)22-17(25)19-11-13-8-5-4-6-9-13/h4-6,8-10,12H,3,7,11H2,1-2H3,(H,20,21,23)(H2,19,22,24,25)/t12-/m1/s1 |
| InChIKey | UYGSEXVJPQNEBC-GFCCVEGCSA-N |
| XLogP | 2.23 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |