C6H8BrN3OS — CID 135703673
4-amino-2-(2-bromoethylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 135703673) has the molecular formula C6H8BrN3OS and a molecular weight of 250.12 g/mol. Its IUPAC name is 4-amino-2-(2-bromoethylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(2-bromoethylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135703673 |
| Molecular Formula | C6H8BrN3OS |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 4-amino-2-(2-bromoethylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCCBr)n1 |
| InChI | InChI=1S/C6H8BrN3OS/c7-1-2-12-6-9-4(8)3-5(11)10-6/h3H,1-2H2,(H3,8,9,10,11) |
| InChIKey | NNOPVTURWVFVCW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|