C11H11BrN4OS — CID 136999058
4-amino-2-[(3-amino-4-bromophenyl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 136999058) has the molecular formula C11H11BrN4OS and a molecular weight of 327.21 g/mol. Its IUPAC name is 4-amino-2-[(3-amino-4-bromophenyl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(3-amino-4-bromophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136999058 |
| Molecular Formula | C11H11BrN4OS |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 4-amino-2-[(3-amino-4-bromophenyl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCc2ccc(Br)c(N)c2)n1 |
| InChI | InChI=1S/C11H11BrN4OS/c12-7-2-1-6(3-8(7)13)5-18-11-15-9(14)4-10(17)16-11/h1-4H,5,13H2,(H3,14,15,16,17) |
| InChIKey | SXXNJHJVCAOMJA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|