C14H15N3O3S — CID 136846961
2-[4-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]phenyl]propanoic acid (PubChem CID 136846961) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[4-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 136846961 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-[4-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanylmethyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CSc2nc(N)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C14H15N3O3S/c1-8(13(19)20)10-4-2-9(3-5-10)7-21-14-16-11(15)6-12(18)17-14/h2-6,8H,7H2,1H3,(H,19,20)(H3,15,16,17,18) |
| InChIKey | AOXMGNIMKKRTJX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |