C9H8BrN3OS2 — CID 135991818
4-amino-2-[(4-bromothiophen-2-yl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 135991818) has the molecular formula C9H8BrN3OS2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 4-amino-2-[(4-bromothiophen-2-yl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(4-bromothiophen-2-yl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135991818 |
| Molecular Formula | C9H8BrN3OS2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | 4-amino-2-[(4-bromothiophen-2-yl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCc2cc(Br)cs2)n1 |
| InChI | InChI=1S/C9H8BrN3OS2/c10-5-1-6(15-3-5)4-16-9-12-7(11)2-8(14)13-9/h1-3H,4H2,(H3,11,12,13,14) |
| InChIKey | YROQXLQEVRUWCI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |