C9H10N6OS — CID 136726580
4-amino-2-[(5-aminopyrazin-2-yl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 136726580) has the molecular formula C9H10N6OS and a molecular weight of 250.29 g/mol. Its IUPAC name is 4-amino-2-[(5-aminopyrazin-2-yl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(5-aminopyrazin-2-yl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136726580 |
| Molecular Formula | C9H10N6OS |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-amino-2-[(5-aminopyrazin-2-yl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1cnc(CSc2nc(N)cc(=O)[nH]2)cn1 |
| InChI | InChI=1S/C9H10N6OS/c10-6-1-8(16)15-9(14-6)17-4-5-2-13-7(11)3-12-5/h1-3H,4H2,(H2,11,13)(H3,10,14,15,16) |
| InChIKey | VAMUHRPOFKBZNQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |