C9H11N5OS — CID 135967603
4-amino-2-(2-imidazol-1-ylethylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 135967603) has the molecular formula C9H11N5OS and a molecular weight of 237.29 g/mol. Its IUPAC name is 4-amino-2-(2-imidazol-1-ylethylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(2-imidazol-1-ylethylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135967603 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-amino-2-(2-imidazol-1-ylethylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(SCCn2ccnc2)n1 |
| InChI | InChI=1S/C9H11N5OS/c10-7-5-8(15)13-9(12-7)16-4-3-14-2-1-11-6-14/h1-2,5-6H,3-4H2,(H3,10,12,13,15) |
| InChIKey | UJNUBECSLYYJBX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |