C24H24N4O4S2 — CID 23175652
2-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propylsulfonyl]pyrimidine (PubChem CID 23175652) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propylsulfonyl]pyrimidine.
| Compound Name | 2-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propylsulfonyl]pyrimidine |
|---|---|
| PubChem CID | 23175652 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propylsulfonyl]pyrimidine |
| SMILES | COc1ccc(-c2nc(SCCCS(=O)(=O)c3ncccn3)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O4S2/c1-31-19-9-5-17(6-10-19)21-22(18-7-11-20(32-2)12-8-18)28-23(27-21)33-15-4-16-34(29,30)24-25-13-3-14-26-24/h3,5-14H,4,15-16H2,1-2H3,(H,27,28) |
| InChIKey | OILGPIJTCMHFKR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|